C17H13BrF4N2O4 — CID 155074316
1-[2-fluoro-5-(trifluoromethoxy)phenyl]ethylcarbamoyl 5-bromo-2-methylpyridine-3-carboxylate (PubChem CID 155074316) has the molecular formula C17H13BrF4N2O4 and a molecular weight of 465.20 g/mol. Its IUPAC name is 1-[2-fluoro-5-(trifluoromethoxy)phenyl]ethylcarbamoyl 5-bromo-2-methylpyridine-3-carboxylate.
| Compound Name | 1-[2-fluoro-5-(trifluoromethoxy)phenyl]ethylcarbamoyl 5-bromo-2-methylpyridine-3-carboxylate |
|---|---|
| PubChem CID | 155074316 |
| Molecular Formula | C17H13BrF4N2O4 |
| Molecular Weight | 465.20 g/mol |
| Exact Mass | 464.00 |
| IUPAC Name | 1-[2-fluoro-5-(trifluoromethoxy)phenyl]ethylcarbamoyl 5-bromo-2-methylpyridine-3-carboxylate |
| SMILES | Cc1ncc(Br)cc1C(=O)OC(=O)NC(C)c1cc(OC(F)(F)F)ccc1F |
| InChI | InChI=1S/C17H13BrF4N2O4/c1-8-13(5-10(18)7-23-8)15(25)27-16(26)24-9(2)12-6-11(3-4-14(12)19)28-17(20,21)22/h3-7,9H,1-2H3,(H,24,26) |
| InChIKey | MKJFBYKZRWFCBJ-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 77.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.20 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|