C32H50O6 — CID 15508092
[(1R,2S,3R,4S,4aR,6aR,6aS,6bR,8R,8aR,12aR,14bS)-3,4,8-trihydroxy-1,2,6a,6b,9,9,12a-heptamethyl-10-oxo-1,2,3,4,5,6,6a,7,8,8a,11,12,13,14b-tetradecahydropicen-4a-yl]methyl acetate (PubChem CID 15508092) has the molecular formula C32H50O6 and a molecular weight of 530.75 g/mol. Its IUPAC name is [(1R,2S,3R,4S,4aR,6aR,6aS,6bR,8R,8aR,12aR,14bS)-3,4,8-trihydroxy-1,2,6a,6b,9,9,12a-heptamethyl-10-oxo-1,2,3,4,5,6,6a,7,8,8a,11,12,13,14b-tetradecahydropicen-4a-yl]methyl acetate.
| Compound Name | [(1R,2S,3R,4S,4aR,6aR,6aS,6bR,8R,8aR,12aR,14bS)-3,4,8-trihydroxy-1,2,6a,6b,9,9,12a-heptamethyl-10-oxo-1,2,3,4,5,6,6a,7,8,8a,11,12,13,14b-tetradecahydropicen-4a-yl]methyl acetate |
|---|---|
| PubChem CID | 15508092 |
| Molecular Formula | C32H50O6 |
| Molecular Weight | 530.75 g/mol |
| Exact Mass | 530.36 |
| IUPAC Name | [(1R,2S,3R,4S,4aR,6aR,6aS,6bR,8R,8aR,12aR,14bS)-3,4,8-trihydroxy-1,2,6a,6b,9,9,12a-heptamethyl-10-oxo-1,2,3,4,5,6,6a,7,8,8a,11,12,13,14b-tetradecahydropicen-4a-yl]methyl acetate |
| SMILES | CC(=O)OC[C@@]12CC[C@]3(C)C(=CC[C@@H]4[C@@]5(C)CCC(=O)C(C)(C)[C@@H]5[C@H](O)C[C@]43C)[C@@H]1[C@@H](C)[C@H](C)[C@@H](O)[C@H]2O |
| InChI | InChI=1S/C32H50O6/c1-17-18(2)25(36)27(37)32(16-38-19(3)33)14-13-30(7)20(24(17)32)9-10-22-29(6)12-11-23(35)28(4,5)26(29)21(34)15-31(22,30)8/h9,17-18,21-22,24-27,34,36-37H,10-16H2,1-8H3/t17-,18-,21+,22+,24-,25+,26-,27+,29+,30+,31+,32-/m0/s1 |
| InChIKey | VOBAGMPXXJJXJW-RSIPRWAKSA-N |
| XLogP | 4.69 |
| TPSA | 104.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.75 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|