C22H25BrN2OS — CID 15508114
(2S,6R)-3,5-dibenzyl-8-bromo-8lambda4-thia-3,5-diazatricyclo[6.3.0.02,6]undecan-4-one (PubChem CID 15508114) has the molecular formula C22H25BrN2OS and a molecular weight of 445.43 g/mol. Its IUPAC name is (2S,6R)-3,5-dibenzyl-8-bromo-8lambda4-thia-3,5-diazatricyclo[6.3.0.02,6]undecan-4-one.
| Compound Name | (2S,6R)-3,5-dibenzyl-8-bromo-8lambda4-thia-3,5-diazatricyclo[6.3.0.02,6]undecan-4-one |
|---|---|
| PubChem CID | 15508114 |
| Molecular Formula | C22H25BrN2OS |
| Molecular Weight | 445.43 g/mol |
| Exact Mass | 444.09 |
| IUPAC Name | (2S,6R)-3,5-dibenzyl-8-bromo-8lambda4-thia-3,5-diazatricyclo[6.3.0.02,6]undecan-4-one |
| SMILES | O=C1N(Cc2ccccc2)[C@@H]2C3CCCS3(Br)C[C@@H]2N1Cc1ccccc1 |
| InChI | InChI=1S/C22H25BrN2OS/c23-27-13-7-12-20(27)21-19(16-27)24(14-17-8-3-1-4-9-17)22(26)25(21)15-18-10-5-2-6-11-18/h1-6,8-11,19-21H,7,12-16H2/t19-,20?,21-/m0/s1 |
| InChIKey | AWMVTFPOTHZTBO-YSTUSHMSSA-N |
| XLogP | 5.15 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.43 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'biotin_analogue', 'substructure': 'N/A'} |
|---|