C24H24F3N5O4S — CID 155083569
N-(2-methoxyethyl)-1-(oxan-4-yl)-2-[[6-(trifluoromethoxy)-1,3-benzothiazol-2-yl]amino]benzimidazole-5-carboxamide (PubChem CID 155083569) has the molecular formula C24H24F3N5O4S and a molecular weight of 535.55 g/mol. Its IUPAC name is N-(2-methoxyethyl)-1-(oxan-4-yl)-2-[[6-(trifluoromethoxy)-1,3-benzothiazol-2-yl]amino]benzimidazole-5-carboxamide.
| Compound Name | N-(2-methoxyethyl)-1-(oxan-4-yl)-2-[[6-(trifluoromethoxy)-1,3-benzothiazol-2-yl]amino]benzimidazole-5-carboxamide |
|---|---|
| PubChem CID | 155083569 |
| Molecular Formula | C24H24F3N5O4S |
| Molecular Weight | 535.55 g/mol |
| Exact Mass | 535.15 |
| IUPAC Name | N-(2-methoxyethyl)-1-(oxan-4-yl)-2-[[6-(trifluoromethoxy)-1,3-benzothiazol-2-yl]amino]benzimidazole-5-carboxamide |
| SMILES | COCCNC(=O)c1ccc2c(c1)nc(Nc1nc3ccc(OC(F)(F)F)cc3s1)n2C1CCOCC1 |
| InChI | InChI=1S/C24H24F3N5O4S/c1-34-11-8-28-21(33)14-2-5-19-18(12-14)29-22(32(19)15-6-9-35-10-7-15)31-23-30-17-4-3-16(13-20(17)37-23)36-24(25,26)27/h2-5,12-13,15H,6-11H2,1H3,(H,28,33)(H,29,30,31) |
| InChIKey | ZWXXNUYIKHODJZ-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 99.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.55 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|