C32H46N4O4 — CID 155083954
3-[[[6-[ethyl(oxan-4-yl)amino]-5-methyl-2-(1-methylpiperidin-4-yl)-1-benzofuran-4-yl]methoxymethylamino]methyl]-4,6-dimethyl-1H-pyridin-2-one (PubChem CID 155083954) has the molecular formula C32H46N4O4 and a molecular weight of 550.74 g/mol. Its IUPAC name is 3-[[[6-[ethyl(oxan-4-yl)amino]-5-methyl-2-(1-methylpiperidin-4-yl)-1-benzofuran-4-yl]methoxymethylamino]methyl]-4,6-dimethyl-1H-pyridin-2-one.
| Compound Name | 3-[[[6-[ethyl(oxan-4-yl)amino]-5-methyl-2-(1-methylpiperidin-4-yl)-1-benzofuran-4-yl]methoxymethylamino]methyl]-4,6-dimethyl-1H-pyridin-2-one |
|---|---|
| PubChem CID | 155083954 |
| Molecular Formula | C32H46N4O4 |
| Molecular Weight | 550.74 g/mol |
| Exact Mass | 550.35 |
| IUPAC Name | 3-[[[6-[ethyl(oxan-4-yl)amino]-5-methyl-2-(1-methylpiperidin-4-yl)-1-benzofuran-4-yl]methoxymethylamino]methyl]-4,6-dimethyl-1H-pyridin-2-one |
| SMILES | CCN(c1cc2oc(C3CCN(C)CC3)cc2c(COCNCc2c(C)cc(C)[nH]c2=O)c1C)C1CCOCC1 |
| InChI | InChI=1S/C32H46N4O4/c1-6-36(25-9-13-38-14-10-25)29-17-31-26(16-30(40-31)24-7-11-35(5)12-8-24)28(23(29)4)19-39-20-33-18-27-21(2)15-22(3)34-32(27)37/h15-17,24-25,33H,6-14,18-20H2,1-5H3,(H,34,37) |
| InChIKey | KNSIJLFMRHMTGT-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 82.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.74 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|