C35H48N4O4 — CID 156547496
3-[[[3-[ethyl(oxan-4-yl)amino]-2-methyl-5-[4-(morpholin-4-ylmethyl)phenyl]phenyl]methoxymethylamino]methyl]-4,6-dimethyl-1H-pyridin-2-one (PubChem CID 156547496) has the molecular formula C35H48N4O4 and a molecular weight of 588.79 g/mol. Its IUPAC name is 3-[[[3-[ethyl(oxan-4-yl)amino]-2-methyl-5-[4-(morpholin-4-ylmethyl)phenyl]phenyl]methoxymethylamino]methyl]-4,6-dimethyl-1H-pyridin-2-one.
| Compound Name | 3-[[[3-[ethyl(oxan-4-yl)amino]-2-methyl-5-[4-(morpholin-4-ylmethyl)phenyl]phenyl]methoxymethylamino]methyl]-4,6-dimethyl-1H-pyridin-2-one |
|---|---|
| PubChem CID | 156547496 |
| Molecular Formula | C35H48N4O4 |
| Molecular Weight | 588.79 g/mol |
| Exact Mass | 588.37 |
| IUPAC Name | 3-[[[3-[ethyl(oxan-4-yl)amino]-2-methyl-5-[4-(morpholin-4-ylmethyl)phenyl]phenyl]methoxymethylamino]methyl]-4,6-dimethyl-1H-pyridin-2-one |
| SMILES | CCN(c1cc(-c2ccc(CN3CCOCC3)cc2)cc(COCNCc2c(C)cc(C)[nH]c2=O)c1C)C1CCOCC1 |
| InChI | InChI=1S/C35H48N4O4/c1-5-39(32-10-14-41-15-11-32)34-20-30(29-8-6-28(7-9-29)22-38-12-16-42-17-13-38)19-31(27(34)4)23-43-24-36-21-33-25(2)18-26(3)37-35(33)40/h6-9,18-20,32,36H,5,10-17,21-24H2,1-4H3,(H,37,40) |
| InChIKey | GBBLABAFLJJOHY-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 79.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.79 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|