C52H36N6 — CID 155085162
N'-[1-[4-(1,10-phenanthrolin-4-yl)phenyl]ethenyl]-N-[1-[4-(1,10-phenanthrolin-4-yl)phenyl]prop-2-enylidene]-7,8-dihydronaphthalene-2-carboximidamide (PubChem CID 155085162) has the molecular formula C52H36N6 and a molecular weight of 744.90 g/mol. Its IUPAC name is N'-[1-[4-(1,10-phenanthrolin-4-yl)phenyl]ethenyl]-N-[1-[4-(1,10-phenanthrolin-4-yl)phenyl]prop-2-enylidene]-7,8-dihydronaphthalene-2-carboximidamide.
| Compound Name | N'-[1-[4-(1,10-phenanthrolin-4-yl)phenyl]ethenyl]-N-[1-[4-(1,10-phenanthrolin-4-yl)phenyl]prop-2-enylidene]-7,8-dihydronaphthalene-2-carboximidamide |
|---|---|
| PubChem CID | 155085162 |
| Molecular Formula | C52H36N6 |
| Molecular Weight | 744.90 g/mol |
| Exact Mass | 744.30 |
| IUPAC Name | N'-[1-[4-(1,10-phenanthrolin-4-yl)phenyl]ethenyl]-N-[1-[4-(1,10-phenanthrolin-4-yl)phenyl]prop-2-enylidene]-7,8-dihydronaphthalene-2-carboximidamide |
| SMILES | C=C/C(=N\C(=N\C(=C)c1ccc(-c2ccnc3c2ccc2cccnc23)cc1)c1ccc2c(c1)CCC=C2)c1ccc(-c2ccnc3c2ccc2cccnc23)cc1 |
| InChI | InChI=1S/C52H36N6/c1-3-47(38-19-17-37(18-20-38)44-27-31-56-51-46(44)25-23-40-11-7-29-54-49(40)51)58-52(42-21-14-35-8-4-5-9-41(35)32-42)57-33(2)34-12-15-36(16-13-34)43-26-30-55-50-45(43)24-22-39-10-6-28-53-48(39)50/h3-4,6-8,10-32H,1-2,5,9H2/b57-52+,58-47+ |
| InChIKey | VMXKZSWBYCDHEI-WCOPAVQUSA-N |
| XLogP | 12.27 |
| TPSA | 76.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 744.90 |
| LogP ≤ 5 | 12.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|