C53H40N4S — CID 154954945
N'-[1-[3-(8,9-dihydrodibenzothiophen-3-yl)-5-(9,10-dihydro-1,10-phenanthrolin-2-yl)phenyl]ethenyl]-4-phenyl-N-(1-phenylethylidene)benzenecarboximidamide (PubChem CID 154954945) has the molecular formula C53H40N4S and a molecular weight of 765.00 g/mol. Its IUPAC name is N'-[1-[3-(8,9-dihydrodibenzothiophen-3-yl)-5-(9,10-dihydro-1,10-phenanthrolin-2-yl)phenyl]ethenyl]-4-phenyl-N-(1-phenylethylidene)benzenecarboximidamide.
| Compound Name | N'-[1-[3-(8,9-dihydrodibenzothiophen-3-yl)-5-(9,10-dihydro-1,10-phenanthrolin-2-yl)phenyl]ethenyl]-4-phenyl-N-(1-phenylethylidene)benzenecarboximidamide |
|---|---|
| PubChem CID | 154954945 |
| Molecular Formula | C53H40N4S |
| Molecular Weight | 765.00 g/mol |
| Exact Mass | 764.30 |
| IUPAC Name | N'-[1-[3-(8,9-dihydrodibenzothiophen-3-yl)-5-(9,10-dihydro-1,10-phenanthrolin-2-yl)phenyl]ethenyl]-4-phenyl-N-(1-phenylethylidene)benzenecarboximidamide |
| SMILES | C=C(/N=C(\N=C(/C)c1ccccc1)c1ccc(-c2ccccc2)cc1)c1cc(-c2ccc3c4c(sc3c2)C=CCC4)cc(-c2ccc3ccc4c(c3n2)NCC=C4)c1 |
| InChI | InChI=1S/C53H40N4S/c1-34(36-12-5-3-6-13-36)55-53(41-23-19-38(20-24-41)37-14-7-4-8-15-37)56-35(2)43-30-44(42-25-27-47-46-17-9-10-18-49(46)58-50(47)33-42)32-45(31-43)48-28-26-40-22-21-39-16-11-29-54-51(39)52(40)57-48/h3-8,10-16,18-28,30-33,54H,2,9,17,29H2,1H3/b55-34+,56-53- |
| InChIKey | GQJKSLUURUGQJA-BBEINOOFSA-N |
| XLogP | 13.78 |
| TPSA | 49.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 765.00 |
| LogP ≤ 5 | 13.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|