C45H29N5 — CID 155086639
9-[2-[2-cyano-4-[3-(3-cyanocarbazol-9-yl)phenyl]phenyl]cyclohex-3-en-1-yl]carbazole-3-carbonitrile (PubChem CID 155086639) has the molecular formula C45H29N5 and a molecular weight of 639.76 g/mol. Its IUPAC name is 9-[2-[2-cyano-4-[3-(3-cyanocarbazol-9-yl)phenyl]phenyl]cyclohex-3-en-1-yl]carbazole-3-carbonitrile.
| Compound Name | 9-[2-[2-cyano-4-[3-(3-cyanocarbazol-9-yl)phenyl]phenyl]cyclohex-3-en-1-yl]carbazole-3-carbonitrile |
|---|---|
| PubChem CID | 155086639 |
| Molecular Formula | C45H29N5 |
| Molecular Weight | 639.76 g/mol |
| Exact Mass | 639.24 |
| IUPAC Name | 9-[2-[2-cyano-4-[3-(3-cyanocarbazol-9-yl)phenyl]phenyl]cyclohex-3-en-1-yl]carbazole-3-carbonitrile |
| SMILES | N#Cc1ccc2c(c1)c1ccccc1n2-c1cccc(-c2ccc(C3C=CCCC3n3c4ccccc4c4cc(C#N)ccc43)c(C#N)c2)c1 |
| InChI | InChI=1S/C45H29N5/c46-26-29-16-20-44-39(22-29)37-11-2-4-13-41(37)49(44)34-9-7-8-31(25-34)32-18-19-35(33(24-32)28-48)36-10-1-5-14-42(36)50-43-15-6-3-12-38(43)40-23-30(27-47)17-21-45(40)50/h1-4,6-13,15-25,36,42H,5,14H2 |
| InChIKey | AWOBNULNLFISJS-UHFFFAOYSA-N |
| XLogP | 10.85 |
| TPSA | 81.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 639.76 |
| LogP ≤ 5 | 10.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|