C16H15Cl2N5O2 — CID 155086804
5,6-dichloro-N-[2-[2-(4-methoxyphenyl)pyrazol-3-yl]oxyethyl]pyrimidin-4-amine (PubChem CID 155086804) has the molecular formula C16H15Cl2N5O2 and a molecular weight of 380.24 g/mol. Its IUPAC name is 5,6-dichloro-N-[2-[2-(4-methoxyphenyl)pyrazol-3-yl]oxyethyl]pyrimidin-4-amine.
| Compound Name | 5,6-dichloro-N-[2-[2-(4-methoxyphenyl)pyrazol-3-yl]oxyethyl]pyrimidin-4-amine |
|---|---|
| PubChem CID | 155086804 |
| Molecular Formula | C16H15Cl2N5O2 |
| Molecular Weight | 380.24 g/mol |
| Exact Mass | 379.06 |
| IUPAC Name | 5,6-dichloro-N-[2-[2-(4-methoxyphenyl)pyrazol-3-yl]oxyethyl]pyrimidin-4-amine |
| SMILES | COc1ccc(-n2nccc2OCCNc2ncnc(Cl)c2Cl)cc1 |
| InChI | InChI=1S/C16H15Cl2N5O2/c1-24-12-4-2-11(3-5-12)23-13(6-7-22-23)25-9-8-19-16-14(17)15(18)20-10-21-16/h2-7,10H,8-9H2,1H3,(H,19,20,21) |
| InChIKey | ZMFTUJQODNSDCL-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 74.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.24 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|