C17H19Cl2N5O — CID 160569200
5-chloro-N-[2-[2-(2-chlorophenyl)pyrazol-3-yl]oxyethyl]-6-methylpyrimidin-4-amine;methane (PubChem CID 160569200) has the molecular formula C17H19Cl2N5O and a molecular weight of 380.28 g/mol. Its IUPAC name is 5-chloro-N-[2-[2-(2-chlorophenyl)pyrazol-3-yl]oxyethyl]-6-methylpyrimidin-4-amine;methane.
| Compound Name | 5-chloro-N-[2-[2-(2-chlorophenyl)pyrazol-3-yl]oxyethyl]-6-methylpyrimidin-4-amine;methane |
|---|---|
| PubChem CID | 160569200 |
| Molecular Formula | C17H19Cl2N5O |
| Molecular Weight | 380.28 g/mol |
| Exact Mass | 379.10 |
| IUPAC Name | 5-chloro-N-[2-[2-(2-chlorophenyl)pyrazol-3-yl]oxyethyl]-6-methylpyrimidin-4-amine;methane |
| SMILES | C.Cc1ncnc(NCCOc2ccnn2-c2ccccc2Cl)c1Cl |
| InChI | InChI=1S/C16H15Cl2N5O.CH4/c1-11-15(18)16(21-10-20-11)19-8-9-24-14-6-7-22-23(14)13-5-3-2-4-12(13)17;/h2-7,10H,8-9H2,1H3,(H,19,20,21);1H4 |
| InChIKey | NGJVRUKIYITKNR-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 64.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.28 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|