C19H26ClN3O — CID 15588065
N-[2-(4-butan-2-yl-2-ethylphenoxy)ethyl]-5-chloro-6-methylpyrimidin-4-amine (PubChem CID 15588065) has the molecular formula C19H26ClN3O and a molecular weight of 347.89 g/mol. Its IUPAC name is N-[2-(4-butan-2-yl-2-ethylphenoxy)ethyl]-5-chloro-6-methylpyrimidin-4-amine.
| Compound Name | N-[2-(4-butan-2-yl-2-ethylphenoxy)ethyl]-5-chloro-6-methylpyrimidin-4-amine |
|---|---|
| PubChem CID | 15588065 |
| Molecular Formula | C19H26ClN3O |
| Molecular Weight | 347.89 g/mol |
| Exact Mass | 347.18 |
| IUPAC Name | N-[2-(4-butan-2-yl-2-ethylphenoxy)ethyl]-5-chloro-6-methylpyrimidin-4-amine |
| SMILES | CCc1cc(C(C)CC)ccc1OCCNc1ncnc(C)c1Cl |
| InChI | InChI=1S/C19H26ClN3O/c1-5-13(3)16-7-8-17(15(6-2)11-16)24-10-9-21-19-18(20)14(4)22-12-23-19/h7-8,11-13H,5-6,9-10H2,1-4H3,(H,21,22,23) |
| InChIKey | HYVYAOOZRUXRCZ-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.89 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|