C23H25ClFN3O4S — CID 155090538
2-[(4-chloro-2-fluorophenyl)methoxy]-4-piperidin-4-ylpyrimidine;4-methylbenzenesulfonic acid (PubChem CID 155090538) has the molecular formula C23H25ClFN3O4S and a molecular weight of 493.99 g/mol. Its IUPAC name is 2-[(4-chloro-2-fluorophenyl)methoxy]-4-piperidin-4-ylpyrimidine;4-methylbenzenesulfonic acid.
| Compound Name | 2-[(4-chloro-2-fluorophenyl)methoxy]-4-piperidin-4-ylpyrimidine;4-methylbenzenesulfonic acid |
|---|---|
| PubChem CID | 155090538 |
| Molecular Formula | C23H25ClFN3O4S |
| Molecular Weight | 493.99 g/mol |
| Exact Mass | 493.12 |
| IUPAC Name | 2-[(4-chloro-2-fluorophenyl)methoxy]-4-piperidin-4-ylpyrimidine;4-methylbenzenesulfonic acid |
| SMILES | Cc1ccc(S(=O)(=O)O)cc1.Fc1cc(Cl)ccc1COc1nccc(C2CCNCC2)n1 |
| InChI | InChI=1S/C16H17ClFN3O.C7H8O3S/c17-13-2-1-12(14(18)9-13)10-22-16-20-8-5-15(21-16)11-3-6-19-7-4-11;1-6-2-4-7(5-3-6)11(8,9)10/h1-2,5,8-9,11,19H,3-4,6-7,10H2;2-5H,1H3,(H,8,9,10) |
| InChIKey | FYLBLWBDLQEZED-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 101.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.99 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|