C43H32F4N2O3 — CID 15509213
4-[3-(4-carbazol-9-ylphenyl)-3-[2-fluoro-4-(trifluoromethyl)phenyl]-8-methoxybenzo[f]chromen-6-yl]morpholine (PubChem CID 15509213) has the molecular formula C43H32F4N2O3 and a molecular weight of 700.73 g/mol. Its IUPAC name is 4-[3-(4-carbazol-9-ylphenyl)-3-[2-fluoro-4-(trifluoromethyl)phenyl]-8-methoxybenzo[f]chromen-6-yl]morpholine.
| Compound Name | 4-[3-(4-carbazol-9-ylphenyl)-3-[2-fluoro-4-(trifluoromethyl)phenyl]-8-methoxybenzo[f]chromen-6-yl]morpholine |
|---|---|
| PubChem CID | 15509213 |
| Molecular Formula | C43H32F4N2O3 |
| Molecular Weight | 700.73 g/mol |
| Exact Mass | 700.23 |
| IUPAC Name | 4-[3-(4-carbazol-9-ylphenyl)-3-[2-fluoro-4-(trifluoromethyl)phenyl]-8-methoxybenzo[f]chromen-6-yl]morpholine |
| SMILES | COc1ccc2c3c(cc(N4CCOCC4)c2c1)OC(c1ccc(-n2c4ccccc4c4ccccc42)cc1)(c1ccc(C(F)(F)F)cc1F)C=C3 |
| InChI | InChI=1S/C43H32F4N2O3/c1-50-30-15-16-31-34-18-19-42(36-17-12-28(24-37(36)44)43(45,46)47,52-41(34)26-40(35(31)25-30)48-20-22-51-23-21-48)27-10-13-29(14-11-27)49-38-8-4-2-6-32(38)33-7-3-5-9-39(33)49/h2-19,24-26H,20-23H2,1H3 |
| InChIKey | CHFUVFFHOLLSGK-UHFFFAOYSA-N |
| XLogP | 10.29 |
| TPSA | 35.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 700.73 |
| LogP ≤ 5 | 10.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'} |
|---|