C12H15F6N3O4S — CID 155092596
N,N-dimethyl-4,5,6,7-tetrahydro-[1,3]thiazolo[5,4-c]pyridin-2-amine;bis(2,2,2-trifluoroacetic acid) (PubChem CID 155092596) has the molecular formula C12H15F6N3O4S and a molecular weight of 411.32 g/mol. Its IUPAC name is N,N-dimethyl-4,5,6,7-tetrahydro-[1,3]thiazolo[5,4-c]pyridin-2-amine;bis(2,2,2-trifluoroacetic acid).
| Compound Name | N,N-dimethyl-4,5,6,7-tetrahydro-[1,3]thiazolo[5,4-c]pyridin-2-amine;bis(2,2,2-trifluoroacetic acid) |
|---|---|
| PubChem CID | 155092596 |
| Molecular Formula | C12H15F6N3O4S |
| Molecular Weight | 411.32 g/mol |
| Exact Mass | 411.07 |
| IUPAC Name | N,N-dimethyl-4,5,6,7-tetrahydro-[1,3]thiazolo[5,4-c]pyridin-2-amine;bis(2,2,2-trifluoroacetic acid) |
| SMILES | CN(C)c1nc2c(s1)CNCC2.O=C(O)C(F)(F)F.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C8H13N3S.2C2HF3O2/c1-11(2)8-10-6-3-4-9-5-7(6)12-8;2*3-2(4,5)1(6)7/h9H,3-5H2,1-2H3;2*(H,6,7) |
| InChIKey | IQBWIEILLYZMKD-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 102.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.32 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |