C12H14F3N3OS — CID 4266255
4-[(5-ethyl-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridin-2-yl)amino]-1,1,1-trifluorobut-3-en-2-one (PubChem CID 4266255) has the molecular formula C12H14F3N3OS and a molecular weight of 305.32 g/mol. Its IUPAC name is 4-[(5-ethyl-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridin-2-yl)amino]-1,1,1-trifluorobut-3-en-2-one.
| Compound Name | 4-[(5-ethyl-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridin-2-yl)amino]-1,1,1-trifluorobut-3-en-2-one |
|---|---|
| PubChem CID | 4266255 |
| Molecular Formula | C12H14F3N3OS |
| Molecular Weight | 305.32 g/mol |
| Exact Mass | 305.08 |
| IUPAC Name | 4-[(5-ethyl-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridin-2-yl)amino]-1,1,1-trifluorobut-3-en-2-one |
| SMILES | CCN1CCc2nc(NC=CC(=O)C(F)(F)F)sc2C1 |
| InChI | InChI=1S/C12H14F3N3OS/c1-2-18-6-4-8-9(7-18)20-11(17-8)16-5-3-10(19)12(13,14)15/h3,5H,2,4,6-7H2,1H3,(H,16,17) |
| InChIKey | JMEKHBFFIRNLKT-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.32 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|