C9H11F3N4OS — CID 108866001
1-(5-methyl-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridin-2-yl)-3-(trifluoromethyl)urea (PubChem CID 108866001) has the molecular formula C9H11F3N4OS and a molecular weight of 280.28 g/mol. Its IUPAC name is 1-(5-methyl-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridin-2-yl)-3-(trifluoromethyl)urea.
| Compound Name | 1-(5-methyl-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridin-2-yl)-3-(trifluoromethyl)urea |
|---|---|
| PubChem CID | 108866001 |
| Molecular Formula | C9H11F3N4OS |
| Molecular Weight | 280.28 g/mol |
| Exact Mass | 280.06 |
| IUPAC Name | 1-(5-methyl-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridin-2-yl)-3-(trifluoromethyl)urea |
| SMILES | CN1CCc2nc(NC(=O)NC(F)(F)F)sc2C1 |
| InChI | InChI=1S/C9H11F3N4OS/c1-16-3-2-5-6(4-16)18-8(13-5)14-7(17)15-9(10,11)12/h2-4H2,1H3,(H2,13,14,15,17) |
| InChIKey | ADUROIVGXLZBAK-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 57.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.28 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|