About 6-bromo-3,4-dihydro-2H-1,5-naphthyridine-1-carboxylic acid
6-bromo-3,4-dihydro-2H-1,5-naphthyridine-1-carboxylic acid (PubChem CID 155093131) has the molecular formula C9H9BrN2O2
and a molecular weight of 257.09 g/mol. Its IUPAC name is 6-bromo-3,4-dihydro-2H-1,5-naphthyridine-1-carboxylic acid.
Molecular Properties
| Compound Name | 6-bromo-3,4-dihydro-2H-1,5-naphthyridine-1-carboxylic acid |
| PubChem CID | 155093131 |
| Molecular Formula | C9H9BrN2O2 |
| Molecular Weight | 257.09 g/mol |
| Exact Mass | 255.98 |
| IUPAC Name | 6-bromo-3,4-dihydro-2H-1,5-naphthyridine-1-carboxylic acid |
| SMILES | O=C(O)N1CCCc2nc(Br)ccc21 |
| InChI | InChI=1S/C9H9BrN2O2/c10-8-4-3-7-6(11-8)2-1-5-12(7)9(13)14/h3-4H,1-2,5H2,(H,13,14) |
| InChIKey | GRXVFNFADRIDOK-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 53.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 257.09 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze 6-bromo-3,4-dihydro-2H-1,5-naphthyridine-1-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-bromo-3,4-dihydro-2H-1,5-naphthyridine-1-carboxylic acid?
The IUPAC name of 6-bromo-3,4-dihydro-2H-1,5-naphthyridine-1-carboxylic acid (CID 155093131) is 6-bromo-3,4-dihydro-2H-1,5-naphthyridine-1-carboxylic acid.
What is the SMILES notation for 6-bromo-3,4-dihydro-2H-1,5-naphthyridine-1-carboxylic acid?
The canonical SMILES for 6-bromo-3,4-dihydro-2H-1,5-naphthyridine-1-carboxylic acid is O=C(O)N1CCCc2nc(Br)ccc21.
What is the InChIKey of 6-bromo-3,4-dihydro-2H-1,5-naphthyridine-1-carboxylic acid?
The InChIKey is GRXVFNFADRIDOK-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9BrN2O2/c10-8-4-3-7-6(11-8)2-1-5-12(7)9(13)14/h3-4H,1-2,5H2,(H,13,14).
What are the key properties of 6-bromo-3,4-dihydro-2H-1,5-naphthyridine-1-carboxylic acid?
6-bromo-3,4-dihydro-2H-1,5-naphthyridine-1-carboxylic acid has a molecular weight of 257.09 g/mol, XLogP of 2.27, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-bromo-3,4-dihydro-2H-1,5-naphthyridine-1-carboxylic acid is sourced from PubChem (CID 155093131), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).