C17H25N3O3 — CID 155094277
[(3S,5S)-1-benzyl-5-morpholin-4-ylpiperidin-3-yl]carbamic acid (PubChem CID 155094277) has the molecular formula C17H25N3O3 and a molecular weight of 319.40 g/mol. Its IUPAC name is [(3S,5S)-1-benzyl-5-morpholin-4-ylpiperidin-3-yl]carbamic acid.
| Compound Name | [(3S,5S)-1-benzyl-5-morpholin-4-ylpiperidin-3-yl]carbamic acid |
|---|---|
| PubChem CID | 155094277 |
| Molecular Formula | C17H25N3O3 |
| Molecular Weight | 319.40 g/mol |
| Exact Mass | 319.19 |
| IUPAC Name | [(3S,5S)-1-benzyl-5-morpholin-4-ylpiperidin-3-yl]carbamic acid |
| SMILES | O=C(O)N[C@H]1C[C@H](N2CCOCC2)CN(Cc2ccccc2)C1 |
| InChI | InChI=1S/C17H25N3O3/c21-17(22)18-15-10-16(20-6-8-23-9-7-20)13-19(12-15)11-14-4-2-1-3-5-14/h1-5,15-16,18H,6-13H2,(H,21,22)/t15-,16-/m0/s1 |
| InChIKey | GGYKJCJUQCKODG-HOTGVXAUSA-N |
| XLogP | 1.23 |
| TPSA | 65.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.40 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |