C21H27F2N10O6PS — CID 155094349
2-amino-9-[(4R,5R,9R,10S)-9-[(R)-(6-aminopurin-9-yl)-fluoromethyl]-5-fluoro-2-hydroxy-6,10-dimethoxy-2-sulfanylidene-1,3-dioxa-2λ5-phosphacycloundec-4-yl]-1H-purin-6-one (PubChem CID 155094349) has the molecular formula C21H27F2N10O6PS and a molecular weight of 616.55 g/mol. Its IUPAC name is 2-amino-9-[(4R,5R,9R,10S)-9-[(R)-(6-aminopurin-9-yl)-fluoromethyl]-5-fluoro-2-hydroxy-6,10-dimethoxy-2-sulfanylidene-1,3-dioxa-2λ5-phosphacycloundec-4-yl]-1H-purin-6-one.
| Compound Name | 2-amino-9-[(4R,5R,9R,10S)-9-[(R)-(6-aminopurin-9-yl)-fluoromethyl]-5-fluoro-2-hydroxy-6,10-dimethoxy-2-sulfanylidene-1,3-dioxa-2λ5-phosphacycloundec-4-yl]-1H-purin-6-one |
|---|---|
| PubChem CID | 155094349 |
| Molecular Formula | C21H27F2N10O6PS |
| Molecular Weight | 616.55 g/mol |
| Exact Mass | 616.15 |
| IUPAC Name | 2-amino-9-[(4R,5R,9R,10S)-9-[(R)-(6-aminopurin-9-yl)-fluoromethyl]-5-fluoro-2-hydroxy-6,10-dimethoxy-2-sulfanylidene-1,3-dioxa-2λ5-phosphacycloundec-4-yl]-1H-purin-6-one |
| SMILES | COC1CC[C@@H]([C@@H](F)n2cnc3c(N)ncnc32)[C@H](OC)COP(O)(=S)O[C@@H](n2cnc3c(=O)[nH]c(N)nc32)[C@@H]1F |
| InChI | InChI=1S/C21H27F2N10O6PS/c1-36-10-4-3-9(15(23)32-7-28-13-16(24)26-6-27-17(13)32)11(37-2)5-38-40(35,41)39-20(12(10)22)33-8-29-14-18(33)30-21(25)31-19(14)34/h6-12,15,20H,3-5H2,1-2H3,(H,35,41)(H2,24,26,27)(H3,25,30,31,34)/t9-,10?,11-,12-,15+,20-,40?/m1/s1 |
| InChIKey | MIUGEWRTWYYTCQ-BOPPTCRNSA-N |
| XLogP | 1.12 |
| TPSA | 216.36 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 616.55 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|