C21H23B2FN10O10P2S — CID 174118364
CID 174118364 (PubChem CID 174118364) has the molecular formula C21H23B2FN10O10P2S and a molecular weight of 710.11 g/mol.
| Compound Name | CID 174118364 |
|---|---|
| PubChem CID | 174118364 |
| Molecular Formula | C21H23B2FN10O10P2S |
| Molecular Weight | 710.11 g/mol |
| Exact Mass | 710.10 |
| IUPAC Name | — |
| SMILES | [B]C12COP(O)(=S)OC3C(OC)C(CO[P@]([B])(=O)OC1C(F)C(n1cnc4c(N)ncnc41)O2)OC3n1cnc2c(=O)[nH]c(N)nc21 |
| InChI | InChI=1S/C21H23B2FN10O10P2S/c1-38-11-7-2-39-45(23,36)44-13-8(24)18(33-5-29-9-14(25)27-4-28-15(9)33)42-21(13,22)3-40-46(37,47)43-12(11)19(41-7)34-6-30-10-16(34)31-20(26)32-17(10)35/h4-8,11-13,18-19H,2-3H2,1H3,(H,37,47)(H2,25,27,28)(H3,26,31,32,35)/t7?,8?,11?,12?,13?,18?,19?,21?,45-,46?/m0/s1 |
| InChIKey | XYNIIPRTEOBXRM-XTPUWSJVSA-N |
| XLogP | -0.92 |
| TPSA | 261.12 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 19 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 710.11 |
| LogP ≤ 5 | -0.92 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 19 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|