C21H24BFN10O10P2 — CID 174062914
CID 174062914 (PubChem CID 174062914) has the molecular formula C21H24BFN10O10P2 and a molecular weight of 668.24 g/mol.
| Compound Name | CID 174062914 |
|---|---|
| PubChem CID | 174062914 |
| Molecular Formula | C21H24BFN10O10P2 |
| Molecular Weight | 668.24 g/mol |
| Exact Mass | 668.12 |
| IUPAC Name | — |
| SMILES | [B][P@@]1OCC2O[C@@H](n3cnc4c(N)ncnc43)C(F)[C@H]2OP(=O)(O)OCC2O[C@@H](n3cnc4c(=O)[nH]c(N)nc43)C(O1)[C@H]2OC |
| InChI | InChI=1S/C21H24BFN10O10P2/c1-37-13-8-3-39-45(35,36)43-12-7(40-19(9(12)23)32-5-28-10-15(24)26-4-27-16(10)32)2-38-44(22)42-14(13)20(41-8)33-6-29-11-17(33)30-21(25)31-18(11)34/h4-9,12-14,19-20H,2-3H2,1H3,(H,35,36)(H2,24,26,27)(H3,25,30,31,34)/t7?,8?,9?,12-,13-,14?,19+,20+,44-/m0/s1 |
| InChIKey | CCIPZHVGYRASFR-VGTJCNMWSA-N |
| XLogP | -0.42 |
| TPSA | 261.12 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 18 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 668.24 |
| LogP ≤ 5 | -0.42 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 18 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|