C22H25F2N10O9P — CID 146214523
2-amino-9-[8-(6-aminopurin-9-yl)-9,18-difluoro-3,13-dihydroxy-3-oxo-2,4,7,11,16-pentaoxa-3λ5-phosphatricyclo[13.2.1.06,10]octadecan-17-yl]-1H-purin-6-one (PubChem CID 146214523) has the molecular formula C22H25F2N10O9P and a molecular weight of 642.47 g/mol. Its IUPAC name is 2-amino-9-[8-(6-aminopurin-9-yl)-9,18-difluoro-3,13-dihydroxy-3-oxo-2,4,7,11,16-pentaoxa-3λ5-phosphatricyclo[13.2.1.06,10]octadecan-17-yl]-1H-purin-6-one.
| Compound Name | 2-amino-9-[8-(6-aminopurin-9-yl)-9,18-difluoro-3,13-dihydroxy-3-oxo-2,4,7,11,16-pentaoxa-3λ5-phosphatricyclo[13.2.1.06,10]octadecan-17-yl]-1H-purin-6-one |
|---|---|
| PubChem CID | 146214523 |
| Molecular Formula | C22H25F2N10O9P |
| Molecular Weight | 642.47 g/mol |
| Exact Mass | 642.15 |
| IUPAC Name | 2-amino-9-[8-(6-aminopurin-9-yl)-9,18-difluoro-3,13-dihydroxy-3-oxo-2,4,7,11,16-pentaoxa-3λ5-phosphatricyclo[13.2.1.06,10]octadecan-17-yl]-1H-purin-6-one |
| SMILES | Nc1nc2c(ncn2C2OC3CC(O)COC4C(COP(=O)(O)OC2C3F)OC(n2cnc3c(N)ncnc32)C4F)c(=O)[nH]1 |
| InChI | InChI=1S/C22H25F2N10O9P/c23-10-8-1-7(35)2-39-14-9(42-20(11(14)24)33-5-29-12-16(25)27-4-28-17(12)33)3-40-44(37,38)43-15(10)21(41-8)34-6-30-13-18(34)31-22(26)32-19(13)36/h4-11,14-15,20-21,35H,1-3H2,(H,37,38)(H2,25,27,28)(H3,26,31,32,36) |
| InChIKey | FJRVGGHLVMWZKC-UHFFFAOYSA-N |
| XLogP | -0.75 |
| TPSA | 262.89 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 17 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 642.47 |
| LogP ≤ 5 | -0.75 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 17 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|