C22H26FN10O9P — CID 146214738
2-amino-9-[(1S,15R)-8-(6-aminopurin-9-yl)-9-fluoro-3,13-dihydroxy-3-oxo-2,4,7,11,16-pentaoxa-3λ5-phosphatricyclo[13.2.1.06,10]octadecan-17-yl]-1H-purin-6-one (PubChem CID 146214738) has the molecular formula C22H26FN10O9P and a molecular weight of 624.48 g/mol. Its IUPAC name is 2-amino-9-[(1S,15R)-8-(6-aminopurin-9-yl)-9-fluoro-3,13-dihydroxy-3-oxo-2,4,7,11,16-pentaoxa-3λ5-phosphatricyclo[13.2.1.06,10]octadecan-17-yl]-1H-purin-6-one.
| Compound Name | 2-amino-9-[(1S,15R)-8-(6-aminopurin-9-yl)-9-fluoro-3,13-dihydroxy-3-oxo-2,4,7,11,16-pentaoxa-3λ5-phosphatricyclo[13.2.1.06,10]octadecan-17-yl]-1H-purin-6-one |
|---|---|
| PubChem CID | 146214738 |
| Molecular Formula | C22H26FN10O9P |
| Molecular Weight | 624.48 g/mol |
| Exact Mass | 624.16 |
| IUPAC Name | 2-amino-9-[(1S,15R)-8-(6-aminopurin-9-yl)-9-fluoro-3,13-dihydroxy-3-oxo-2,4,7,11,16-pentaoxa-3λ5-phosphatricyclo[13.2.1.06,10]octadecan-17-yl]-1H-purin-6-one |
| SMILES | Nc1nc2c(ncn2C2O[C@@H]3CC(O)COC4C(COP(=O)(O)O[C@H]2C3)OC(n2cnc3c(N)ncnc32)C4F)c(=O)[nH]1 |
| InChI | InChI=1S/C22H26FN10O9P/c23-12-15-11(41-21(12)32-6-28-13-16(24)26-5-27-17(13)32)4-39-43(36,37)42-10-2-9(1-8(34)3-38-15)40-20(10)33-7-29-14-18(33)30-22(25)31-19(14)35/h5-12,15,20-21,34H,1-4H2,(H,36,37)(H2,24,26,27)(H3,25,30,31,35)/t8?,9-,10+,11?,12?,15?,20?,21?/m1/s1 |
| InChIKey | BXKLHADMGBFDHD-BEBYEEKKSA-N |
| XLogP | -0.70 |
| TPSA | 262.89 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 17 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 624.48 |
| LogP ≤ 5 | -0.70 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 17 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|