C21H26FN10O8P — CID 137149039
2-amino-9-[[(6S)-13-(6-aminopurin-9-yl)-14-fluoro-8-hydroxy-4-methyl-8-oxo-2,7,9,12-tetraoxa-8λ5-phosphabicyclo[9.3.0]tetradecan-6-yl]-hydroxymethyl]-1H-purin-6-one (PubChem CID 137149039) has the molecular formula C21H26FN10O8P and a molecular weight of 596.47 g/mol. Its IUPAC name is 2-amino-9-[[(6S)-13-(6-aminopurin-9-yl)-14-fluoro-8-hydroxy-4-methyl-8-oxo-2,7,9,12-tetraoxa-8λ5-phosphabicyclo[9.3.0]tetradecan-6-yl]-hydroxymethyl]-1H-purin-6-one.
| Compound Name | 2-amino-9-[[(6S)-13-(6-aminopurin-9-yl)-14-fluoro-8-hydroxy-4-methyl-8-oxo-2,7,9,12-tetraoxa-8λ5-phosphabicyclo[9.3.0]tetradecan-6-yl]-hydroxymethyl]-1H-purin-6-one |
|---|---|
| PubChem CID | 137149039 |
| Molecular Formula | C21H26FN10O8P |
| Molecular Weight | 596.47 g/mol |
| Exact Mass | 596.17 |
| IUPAC Name | 2-amino-9-[[(6S)-13-(6-aminopurin-9-yl)-14-fluoro-8-hydroxy-4-methyl-8-oxo-2,7,9,12-tetraoxa-8λ5-phosphabicyclo[9.3.0]tetradecan-6-yl]-hydroxymethyl]-1H-purin-6-one |
| SMILES | CC1COC2C(COP(=O)(O)O[C@H](C(O)n3cnc4c(=O)[nH]c(N)nc43)C1)OC(n1cnc3c(N)ncnc31)C2F |
| InChI | InChI=1S/C21H26FN10O8P/c1-8-2-9(19(34)31-6-28-13-17(31)29-21(24)30-18(13)33)40-41(35,36)38-4-10-14(37-3-8)11(22)20(39-10)32-7-27-12-15(23)25-5-26-16(12)32/h5-11,14,19-20,34H,2-4H2,1H3,(H,35,36)(H2,23,25,26)(H3,24,29,30,33)/t8?,9-,10?,11?,14?,19?,20?/m0/s1 |
| InChIKey | OFPIQENWCCGDAR-TVNGKLFASA-N |
| XLogP | -0.22 |
| TPSA | 253.66 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.47 |
| LogP ≤ 5 | -0.22 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|