C22H25B2FN10O10P2 — CID 174118107
CID 174118107 (PubChem CID 174118107) has the molecular formula C22H25B2FN10O10P2 and a molecular weight of 692.07 g/mol.
| Compound Name | CID 174118107 |
|---|---|
| PubChem CID | 174118107 |
| Molecular Formula | C22H25B2FN10O10P2 |
| Molecular Weight | 692.07 g/mol |
| Exact Mass | 692.14 |
| IUPAC Name | — |
| SMILES | [B][P@@]1(=O)OCC2(C)OC(n3cnc4c(N)ncnc43)C(F)C2O[P@]([B])(=O)OCC2OC(n3cnc4c(=O)[nH]c(N)nc43)C(O1)C2OC |
| InChI | InChI=1S/C22H25B2FN10O10P2/c1-22-4-41-47(24,38)44-13-12(39-2)8(42-20(13)35-7-31-11-17(35)32-21(27)33-18(11)36)3-40-46(23,37)45-14(22)9(25)19(43-22)34-6-30-10-15(26)28-5-29-16(10)34/h5-9,12-14,19-20H,3-4H2,1-2H3,(H2,26,28,29)(H3,27,32,33,36)/t8?,9?,12?,13?,14?,19?,20?,22?,46-,47-/m1/s1 |
| InChIKey | RISQEHXVSHTXPJ-IOZKUHLVSA-N |
| XLogP | 0.03 |
| TPSA | 257.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 19 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 692.07 |
| LogP ≤ 5 | 0.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 19 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|