C23H23N3O6S2 — CID 155095239
[4-(acridin-9-ylamino)-3-(2-methoxyethyl)phenyl]sulfamoyl methanesulfonate (PubChem CID 155095239) has the molecular formula C23H23N3O6S2 and a molecular weight of 501.59 g/mol. Its IUPAC name is [4-(acridin-9-ylamino)-3-(2-methoxyethyl)phenyl]sulfamoyl methanesulfonate.
| Compound Name | [4-(acridin-9-ylamino)-3-(2-methoxyethyl)phenyl]sulfamoyl methanesulfonate |
|---|---|
| PubChem CID | 155095239 |
| Molecular Formula | C23H23N3O6S2 |
| Molecular Weight | 501.59 g/mol |
| Exact Mass | 501.10 |
| IUPAC Name | [4-(acridin-9-ylamino)-3-(2-methoxyethyl)phenyl]sulfamoyl methanesulfonate |
| SMILES | COCCc1cc(NS(=O)(=O)OS(C)(=O)=O)ccc1Nc1c2ccccc2nc2ccccc12 |
| InChI | InChI=1S/C23H23N3O6S2/c1-31-14-13-16-15-17(26-34(29,30)32-33(2,27)28)11-12-20(16)25-23-18-7-3-5-9-21(18)24-22-10-6-4-8-19(22)23/h3-12,15,26H,13-14H2,1-2H3,(H,24,25) |
| InChIKey | YMWFJHKDLCTRTM-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 123.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.59 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'amino_acridine_A(46)', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|