C23H24N4O3S — CID 14421696
N-[4-(acridin-9-ylamino)-3-[2-hydroxyethyl(methyl)amino]phenyl]methanesulfonamide (PubChem CID 14421696) has the molecular formula C23H24N4O3S and a molecular weight of 436.54 g/mol. Its IUPAC name is N-[4-(acridin-9-ylamino)-3-[2-hydroxyethyl(methyl)amino]phenyl]methanesulfonamide.
| Compound Name | N-[4-(acridin-9-ylamino)-3-[2-hydroxyethyl(methyl)amino]phenyl]methanesulfonamide |
|---|---|
| PubChem CID | 14421696 |
| Molecular Formula | C23H24N4O3S |
| Molecular Weight | 436.54 g/mol |
| Exact Mass | 436.16 |
| IUPAC Name | N-[4-(acridin-9-ylamino)-3-[2-hydroxyethyl(methyl)amino]phenyl]methanesulfonamide |
| SMILES | CN(CCO)c1cc(NS(C)(=O)=O)ccc1Nc1c2ccccc2nc2ccccc12 |
| InChI | InChI=1S/C23H24N4O3S/c1-27(13-14-28)22-15-16(26-31(2,29)30)11-12-21(22)25-23-17-7-3-5-9-19(17)24-20-10-6-4-8-18(20)23/h3-12,15,26,28H,13-14H2,1-2H3,(H,24,25) |
| InChIKey | CIFCKHPVBBJPCG-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 94.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.54 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'amino_acridine_A(46)', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|