C34H35N5O5S — CID 174841228
N-[4-(acridin-9-ylamino)-3-methoxyphenyl]methanesulfonamide;3-(4-aminophenyl)-3-ethylpiperidine-2,6-dione (PubChem CID 174841228) has the molecular formula C34H35N5O5S and a molecular weight of 625.75 g/mol. Its IUPAC name is N-[4-(acridin-9-ylamino)-3-methoxyphenyl]methanesulfonamide;3-(4-aminophenyl)-3-ethylpiperidine-2,6-dione.
| Compound Name | N-[4-(acridin-9-ylamino)-3-methoxyphenyl]methanesulfonamide;3-(4-aminophenyl)-3-ethylpiperidine-2,6-dione |
|---|---|
| PubChem CID | 174841228 |
| Molecular Formula | C34H35N5O5S |
| Molecular Weight | 625.75 g/mol |
| Exact Mass | 625.24 |
| IUPAC Name | N-[4-(acridin-9-ylamino)-3-methoxyphenyl]methanesulfonamide;3-(4-aminophenyl)-3-ethylpiperidine-2,6-dione |
| SMILES | CCC1(c2ccc(N)cc2)CCC(=O)NC1=O.COc1cc(NS(C)(=O)=O)ccc1Nc1c2ccccc2nc2ccccc12 |
| InChI | InChI=1S/C21H19N3O3S.C13H16N2O2/c1-27-20-13-14(24-28(2,25)26)11-12-19(20)23-21-15-7-3-5-9-17(15)22-18-10-6-4-8-16(18)21;1-2-13(8-7-11(16)15-12(13)17)9-3-5-10(14)6-4-9/h3-13,24H,1-2H3,(H,22,23);3-6H,2,7-8,14H2,1H3,(H,15,16,17) |
| InChIKey | NVXGHEBKLSXIFA-UHFFFAOYSA-N |
| XLogP | 5.86 |
| TPSA | 152.51 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 625.75 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'amino_acridine_A(46)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|