C23H21N3O6S — CID 15645740
N-[3-methoxy-4-[(7-methoxy-[1,3]dioxolo[4,5-b]acridin-10-yl)amino]phenyl]methanesulfonamide (PubChem CID 15645740) has the molecular formula C23H21N3O6S and a molecular weight of 467.50 g/mol. Its IUPAC name is N-[3-methoxy-4-[(7-methoxy-[1,3]dioxolo[4,5-b]acridin-10-yl)amino]phenyl]methanesulfonamide.
| Compound Name | N-[3-methoxy-4-[(7-methoxy-[1,3]dioxolo[4,5-b]acridin-10-yl)amino]phenyl]methanesulfonamide |
|---|---|
| PubChem CID | 15645740 |
| Molecular Formula | C23H21N3O6S |
| Molecular Weight | 467.50 g/mol |
| Exact Mass | 467.12 |
| IUPAC Name | N-[3-methoxy-4-[(7-methoxy-[1,3]dioxolo[4,5-b]acridin-10-yl)amino]phenyl]methanesulfonamide |
| SMILES | COc1ccc2c(Nc3ccc(NS(C)(=O)=O)cc3OC)c3cc4c(cc3nc2c1)OCO4 |
| InChI | InChI=1S/C23H21N3O6S/c1-29-14-5-6-15-18(9-14)24-19-11-22-21(31-12-32-22)10-16(19)23(15)25-17-7-4-13(8-20(17)30-2)26-33(3,27)28/h4-11,26H,12H2,1-3H3,(H,24,25) |
| InChIKey | WGRRGHRWRRVBCG-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 108.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.50 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'amino_acridine_A(46)', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|