C18H23N5O6 — CID 155095878
4-O-[[3-[[(E)-N'-(N,N-dimethylcarbamimidoyl)carbamimidoyl]carbamoyloxymethyl]phenyl]methyl] 1-O-methyl (E)-but-2-enedioate (PubChem CID 155095878) has the molecular formula C18H23N5O6 and a molecular weight of 405.41 g/mol. Its IUPAC name is 4-O-[[3-[[(E)-N'-(N,N-dimethylcarbamimidoyl)carbamimidoyl]carbamoyloxymethyl]phenyl]methyl] 1-O-methyl (E)-but-2-enedioate.
| Compound Name | 4-O-[[3-[[(E)-N'-(N,N-dimethylcarbamimidoyl)carbamimidoyl]carbamoyloxymethyl]phenyl]methyl] 1-O-methyl (E)-but-2-enedioate |
|---|---|
| PubChem CID | 155095878 |
| Molecular Formula | C18H23N5O6 |
| Molecular Weight | 405.41 g/mol |
| Exact Mass | 405.16 |
| IUPAC Name | 4-O-[[3-[[(E)-N'-(N,N-dimethylcarbamimidoyl)carbamimidoyl]carbamoyloxymethyl]phenyl]methyl] 1-O-methyl (E)-but-2-enedioate |
| SMILES | [H]/N=C(/N=C(\N)NC(=O)OCc1cccc(COC(=O)/C=C/C(=O)OC)c1)N(C)C |
| InChI | InChI=1S/C18H23N5O6/c1-23(2)17(20)21-16(19)22-18(26)29-11-13-6-4-5-12(9-13)10-28-15(25)8-7-14(24)27-3/h4-9H,10-11H2,1-3H3,(H4,19,20,21,22,26)/b8-7+ |
| InChIKey | YNINJVJUXDWGLF-BQYQJAHWSA-N |
| XLogP | 0.50 |
| TPSA | 156.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.41 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|