C24H27ClF3N7O2 — CID 155098429
N-[4-(4-aminobutylcarbamoyl)-3-chlorophenyl]-1-methyl-5-[1-(2-methylprop-2-enyl)-3-(trifluoromethyl)pyrazol-4-yl]imidazole-2-carboxamide (PubChem CID 155098429) has the molecular formula C24H27ClF3N7O2 and a molecular weight of 537.97 g/mol. Its IUPAC name is N-[4-(4-aminobutylcarbamoyl)-3-chlorophenyl]-1-methyl-5-[1-(2-methylprop-2-enyl)-3-(trifluoromethyl)pyrazol-4-yl]imidazole-2-carboxamide.
| Compound Name | N-[4-(4-aminobutylcarbamoyl)-3-chlorophenyl]-1-methyl-5-[1-(2-methylprop-2-enyl)-3-(trifluoromethyl)pyrazol-4-yl]imidazole-2-carboxamide |
|---|---|
| PubChem CID | 155098429 |
| Molecular Formula | C24H27ClF3N7O2 |
| Molecular Weight | 537.97 g/mol |
| Exact Mass | 537.19 |
| IUPAC Name | N-[4-(4-aminobutylcarbamoyl)-3-chlorophenyl]-1-methyl-5-[1-(2-methylprop-2-enyl)-3-(trifluoromethyl)pyrazol-4-yl]imidazole-2-carboxamide |
| SMILES | C=C(C)Cn1cc(-c2cnc(C(=O)Nc3ccc(C(=O)NCCCCN)c(Cl)c3)n2C)c(C(F)(F)F)n1 |
| InChI | InChI=1S/C24H27ClF3N7O2/c1-14(2)12-35-13-17(20(33-35)24(26,27)28)19-11-31-21(34(19)3)23(37)32-15-6-7-16(18(25)10-15)22(36)30-9-5-4-8-29/h6-7,10-11,13H,1,4-5,8-9,12,29H2,2-3H3,(H,30,36)(H,32,37) |
| InChIKey | ZDYLPCSGBYSYQE-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 119.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.97 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|