C22H23ClF3N7O2 — CID 155120568
N-[4-[(3-aminopropylamino)-hydroxymethyl]-3-chlorophenyl]-1-methyl-5-[1-prop-2-ynyl-3-(trifluoromethyl)pyrazol-4-yl]imidazole-2-carboxamide (PubChem CID 155120568) has the molecular formula C22H23ClF3N7O2 and a molecular weight of 509.92 g/mol. Its IUPAC name is N-[4-[(3-aminopropylamino)-hydroxymethyl]-3-chlorophenyl]-1-methyl-5-[1-prop-2-ynyl-3-(trifluoromethyl)pyrazol-4-yl]imidazole-2-carboxamide.
| Compound Name | N-[4-[(3-aminopropylamino)-hydroxymethyl]-3-chlorophenyl]-1-methyl-5-[1-prop-2-ynyl-3-(trifluoromethyl)pyrazol-4-yl]imidazole-2-carboxamide |
|---|---|
| PubChem CID | 155120568 |
| Molecular Formula | C22H23ClF3N7O2 |
| Molecular Weight | 509.92 g/mol |
| Exact Mass | 509.16 |
| IUPAC Name | N-[4-[(3-aminopropylamino)-hydroxymethyl]-3-chlorophenyl]-1-methyl-5-[1-prop-2-ynyl-3-(trifluoromethyl)pyrazol-4-yl]imidazole-2-carboxamide |
| SMILES | C#CCn1cc(-c2cnc(C(=O)Nc3ccc(C(O)NCCCN)c(Cl)c3)n2C)c(C(F)(F)F)n1 |
| InChI | InChI=1S/C22H23ClF3N7O2/c1-3-9-33-12-15(18(31-33)22(24,25)26)17-11-29-19(32(17)2)21(35)30-13-5-6-14(16(23)10-13)20(34)28-8-4-7-27/h1,5-6,10-12,20,28,34H,4,7-9,27H2,2H3,(H,30,35) |
| InChIKey | RGJYKMACHWRBBU-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 123.02 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.92 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|