C24H28F3N7O4S — CID 157326134
N-[4-[N-(3-aminopropyl)-S-methylsulfonimidoyl]-3-methylphenyl]-1-methyl-5-[1-prop-2-ynyl-3-(trifluoromethyl)pyrazol-4-yl]imidazole-2-carboxamide;formic acid (PubChem CID 157326134) has the molecular formula C24H28F3N7O4S and a molecular weight of 567.59 g/mol. Its IUPAC name is N-[4-[N-(3-aminopropyl)-S-methylsulfonimidoyl]-3-methylphenyl]-1-methyl-5-[1-prop-2-ynyl-3-(trifluoromethyl)pyrazol-4-yl]imidazole-2-carboxamide;formic acid.
| Compound Name | N-[4-[N-(3-aminopropyl)-S-methylsulfonimidoyl]-3-methylphenyl]-1-methyl-5-[1-prop-2-ynyl-3-(trifluoromethyl)pyrazol-4-yl]imidazole-2-carboxamide;formic acid |
|---|---|
| PubChem CID | 157326134 |
| Molecular Formula | C24H28F3N7O4S |
| Molecular Weight | 567.59 g/mol |
| Exact Mass | 567.19 |
| IUPAC Name | N-[4-[N-(3-aminopropyl)-S-methylsulfonimidoyl]-3-methylphenyl]-1-methyl-5-[1-prop-2-ynyl-3-(trifluoromethyl)pyrazol-4-yl]imidazole-2-carboxamide;formic acid |
| SMILES | C#CCn1cc(-c2cnc(C(=O)Nc3ccc(S(C)(=O)=NCCCN)c(C)c3)n2C)c(C(F)(F)F)n1.O=CO |
| InChI | InChI=1S/C23H26F3N7O2S.CH2O2/c1-5-11-33-14-17(20(31-33)23(24,25)26)18-13-28-21(32(18)3)22(34)30-16-7-8-19(15(2)12-16)36(4,35)29-10-6-9-27;2-1-3/h1,7-8,12-14H,6,9-11,27H2,2-4H3,(H,30,34);1H,(H,2,3) |
| InChIKey | BESWEWLGFSDUNR-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 157.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.59 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|