C19H26N4O2 — CID 155099140
tert-butyl-[2-methyl-3-[(5-pyridin-3-yl-2-pyridinyl)amino]propyl]carbamic acid (PubChem CID 155099140) has the molecular formula C19H26N4O2 and a molecular weight of 342.44 g/mol. Its IUPAC name is tert-butyl-[2-methyl-3-[(5-pyridin-3-yl-2-pyridinyl)amino]propyl]carbamic acid.
| Compound Name | tert-butyl-[2-methyl-3-[(5-pyridin-3-yl-2-pyridinyl)amino]propyl]carbamic acid |
|---|---|
| PubChem CID | 155099140 |
| Molecular Formula | C19H26N4O2 |
| Molecular Weight | 342.44 g/mol |
| Exact Mass | 342.21 |
| IUPAC Name | tert-butyl-[2-methyl-3-[(5-pyridin-3-yl-2-pyridinyl)amino]propyl]carbamic acid |
| SMILES | CC(CNc1ccc(-c2cccnc2)cn1)CN(C(=O)O)C(C)(C)C |
| InChI | InChI=1S/C19H26N4O2/c1-14(13-23(18(24)25)19(2,3)4)10-21-17-8-7-16(12-22-17)15-6-5-9-20-11-15/h5-9,11-12,14H,10,13H2,1-4H3,(H,21,22)(H,24,25) |
| InChIKey | GOHHIXCTCYCWDF-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 78.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.44 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |