C16H17N2O4S- — CID 155099995
7-methoxy-4-[4-[(sulfinatoamino)methyl]phenyl]-2,3-dihydro-1,4-benzoxazine (PubChem CID 155099995) has the molecular formula C16H17N2O4S- and a molecular weight of 333.39 g/mol. Its IUPAC name is 7-methoxy-4-[4-[(sulfinatoamino)methyl]phenyl]-2,3-dihydro-1,4-benzoxazine.
| Compound Name | 7-methoxy-4-[4-[(sulfinatoamino)methyl]phenyl]-2,3-dihydro-1,4-benzoxazine |
|---|---|
| PubChem CID | 155099995 |
| Molecular Formula | C16H17N2O4S- |
| Molecular Weight | 333.39 g/mol |
| Exact Mass | 333.09 |
| IUPAC Name | 7-methoxy-4-[4-[(sulfinatoamino)methyl]phenyl]-2,3-dihydro-1,4-benzoxazine |
| SMILES | COc1ccc2c(c1)OCCN2c1ccc(CNS(=O)[O-])cc1 |
| InChI | InChI=1S/C16H18N2O4S/c1-21-14-6-7-15-16(10-14)22-9-8-18(15)13-4-2-12(3-5-13)11-17-23(19)20/h2-7,10,17H,8-9,11H2,1H3,(H,19,20)/p-1 |
| InChIKey | UNMHYOJZLQUDFB-UHFFFAOYSA-M |
| XLogP | 2.11 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.39 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|