About 4-(cyclohexylmethyl)-1,6-dimethyl-3,6-dihydro-2H-pyridine
4-(cyclohexylmethyl)-1,6-dimethyl-3,6-dihydro-2H-pyridine (PubChem CID 155107113) has the molecular formula C14H25N
and a molecular weight of 207.36 g/mol. Its IUPAC name is 4-(cyclohexylmethyl)-1,6-dimethyl-3,6-dihydro-2H-pyridine.
Molecular Properties
| Compound Name | 4-(cyclohexylmethyl)-1,6-dimethyl-3,6-dihydro-2H-pyridine |
| PubChem CID | 155107113 |
| Molecular Formula | C14H25N |
| Molecular Weight | 207.36 g/mol |
| Exact Mass | 207.20 |
| IUPAC Name | 4-(cyclohexylmethyl)-1,6-dimethyl-3,6-dihydro-2H-pyridine |
| SMILES | CC1C=C(CC2CCCCC2)CCN1C |
| InChI | InChI=1S/C14H25N/c1-12-10-14(8-9-15(12)2)11-13-6-4-3-5-7-13/h10,12-13H,3-9,11H2,1-2H3 |
| InChIKey | MKAWPEMHBRZLDI-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 207.36 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 4-(cyclohexylmethyl)-1,6-dimethyl-3,6-dihydro-2H-pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(cyclohexylmethyl)-1,6-dimethyl-3,6-dihydro-2H-pyridine?
The IUPAC name of 4-(cyclohexylmethyl)-1,6-dimethyl-3,6-dihydro-2H-pyridine (CID 155107113) is 4-(cyclohexylmethyl)-1,6-dimethyl-3,6-dihydro-2H-pyridine.
What is the SMILES notation for 4-(cyclohexylmethyl)-1,6-dimethyl-3,6-dihydro-2H-pyridine?
The canonical SMILES for 4-(cyclohexylmethyl)-1,6-dimethyl-3,6-dihydro-2H-pyridine is CC1C=C(CC2CCCCC2)CCN1C.
What is the InChIKey of 4-(cyclohexylmethyl)-1,6-dimethyl-3,6-dihydro-2H-pyridine?
The InChIKey is MKAWPEMHBRZLDI-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H25N/c1-12-10-14(8-9-15(12)2)11-13-6-4-3-5-7-13/h10,12-13H,3-9,11H2,1-2H3.
What are the key properties of 4-(cyclohexylmethyl)-1,6-dimethyl-3,6-dihydro-2H-pyridine?
4-(cyclohexylmethyl)-1,6-dimethyl-3,6-dihydro-2H-pyridine has a molecular weight of 207.36 g/mol, XLogP of 3.61, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(cyclohexylmethyl)-1,6-dimethyl-3,6-dihydro-2H-pyridine is sourced from PubChem (CID 155107113), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).