C14H25N — CID 155107113
4-(cyclohexylmethyl)-1,6-dimethyl-3,6-dihydro-2H-pyridine (PubChem CID 155107113) has the molecular formula C14H25N and a molecular weight of 207.36 g/mol. Its IUPAC name is 4-(cyclohexylmethyl)-1,6-dimethyl-3,6-dihydro-2H-pyridine.
| Compound Name | 4-(cyclohexylmethyl)-1,6-dimethyl-3,6-dihydro-2H-pyridine |
|---|---|
| PubChem CID | 155107113 |
| Molecular Formula | C14H25N |
| Molecular Weight | 207.36 g/mol |
| Exact Mass | 207.20 |
| IUPAC Name | 4-(cyclohexylmethyl)-1,6-dimethyl-3,6-dihydro-2H-pyridine |
| SMILES | CC1C=C(CC2CCCCC2)CCN1C |
| InChI | InChI=1S/C14H25N/c1-12-10-14(8-9-15(12)2)11-13-6-4-3-5-7-13/h10,12-13H,3-9,11H2,1-2H3 |
| InChIKey | MKAWPEMHBRZLDI-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.36 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|