About N-(5-aminopentyl)-N'-(3-sulfanylbutyl)butanediamide
N-(5-aminopentyl)-N'-(3-sulfanylbutyl)butanediamide (PubChem CID 155107995) has the molecular formula C13H27N3O2S
and a molecular weight of 289.44 g/mol. Its IUPAC name is N-(5-aminopentyl)-N'-(3-sulfanylbutyl)butanediamide.
Molecular Properties
| Compound Name | N-(5-aminopentyl)-N'-(3-sulfanylbutyl)butanediamide |
| PubChem CID | 155107995 |
| Molecular Formula | C13H27N3O2S |
| Molecular Weight | 289.44 g/mol |
| Exact Mass | 289.18 |
| IUPAC Name | N-(5-aminopentyl)-N'-(3-sulfanylbutyl)butanediamide |
| SMILES | CC(S)CCNC(=O)CCC(=O)NCCCCCN |
| InChI | InChI=1S/C13H27N3O2S/c1-11(19)7-10-16-13(18)6-5-12(17)15-9-4-2-3-8-14/h11,19H,2-10,14H2,1H3,(H,15,17)(H,16,18) |
| InChIKey | JPXXQELLCXFQPI-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 289.44 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze N-(5-aminopentyl)-N'-(3-sulfanylbutyl)butanediamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(5-aminopentyl)-N'-(3-sulfanylbutyl)butanediamide?
The IUPAC name of N-(5-aminopentyl)-N'-(3-sulfanylbutyl)butanediamide (CID 155107995) is N-(5-aminopentyl)-N'-(3-sulfanylbutyl)butanediamide.
What is the SMILES notation for N-(5-aminopentyl)-N'-(3-sulfanylbutyl)butanediamide?
The canonical SMILES for N-(5-aminopentyl)-N'-(3-sulfanylbutyl)butanediamide is CC(S)CCNC(=O)CCC(=O)NCCCCCN.
What is the InChIKey of N-(5-aminopentyl)-N'-(3-sulfanylbutyl)butanediamide?
The InChIKey is JPXXQELLCXFQPI-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H27N3O2S/c1-11(19)7-10-16-13(18)6-5-12(17)15-9-4-2-3-8-14/h11,19H,2-10,14H2,1H3,(H,15,17)(H,16,18).
What are the key properties of N-(5-aminopentyl)-N'-(3-sulfanylbutyl)butanediamide?
N-(5-aminopentyl)-N'-(3-sulfanylbutyl)butanediamide has a molecular weight of 289.44 g/mol, XLogP of 0.84, 11 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-(5-aminopentyl)-N'-(3-sulfanylbutyl)butanediamide is sourced from PubChem (CID 155107995), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).