C13H24O2 — CID 155110000
2,3,3-trimethylhexan-2-yl (E)-but-2-enoate (PubChem CID 155110000) has the molecular formula C13H24O2 and a molecular weight of 212.33 g/mol. Its IUPAC name is 2,3,3-trimethylhexan-2-yl (E)-but-2-enoate.
| Compound Name | 2,3,3-trimethylhexan-2-yl (E)-but-2-enoate |
|---|---|
| PubChem CID | 155110000 |
| Molecular Formula | C13H24O2 |
| Molecular Weight | 212.33 g/mol |
| Exact Mass | 212.18 |
| IUPAC Name | 2,3,3-trimethylhexan-2-yl (E)-but-2-enoate |
| SMILES | C/C=C/C(=O)OC(C)(C)C(C)(C)CCC |
| InChI | InChI=1S/C13H24O2/c1-7-9-11(14)15-13(5,6)12(3,4)10-8-2/h7,9H,8,10H2,1-6H3/b9-7+ |
| InChIKey | LKMAXVADXONNAV-VQHVLOKHSA-N |
| XLogP | 3.71 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.33 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|