C26H22ClFN4O3 — CID 155110637
3-chloro-N-[(3S)-3,4-dihydroxy-2-(pyridin-2-ylmethyl)butylidene]-2-[3-(4-fluorophenyl)-1H-pyrazol-5-yl]benzamide (PubChem CID 155110637) has the molecular formula C26H22ClFN4O3 and a molecular weight of 492.94 g/mol. Its IUPAC name is 3-chloro-N-[(3S)-3,4-dihydroxy-2-(pyridin-2-ylmethyl)butylidene]-2-[3-(4-fluorophenyl)-1H-pyrazol-5-yl]benzamide.
| Compound Name | 3-chloro-N-[(3S)-3,4-dihydroxy-2-(pyridin-2-ylmethyl)butylidene]-2-[3-(4-fluorophenyl)-1H-pyrazol-5-yl]benzamide |
|---|---|
| PubChem CID | 155110637 |
| Molecular Formula | C26H22ClFN4O3 |
| Molecular Weight | 492.94 g/mol |
| Exact Mass | 492.14 |
| IUPAC Name | 3-chloro-N-[(3S)-3,4-dihydroxy-2-(pyridin-2-ylmethyl)butylidene]-2-[3-(4-fluorophenyl)-1H-pyrazol-5-yl]benzamide |
| SMILES | O=C(/N=C/C(Cc1ccccn1)[C@H](O)CO)c1cccc(Cl)c1-c1cc(-c2ccc(F)cc2)n[nH]1 |
| InChI | InChI=1S/C26H22ClFN4O3/c27-21-6-3-5-20(25(21)23-13-22(31-32-23)16-7-9-18(28)10-8-16)26(35)30-14-17(24(34)15-33)12-19-4-1-2-11-29-19/h1-11,13-14,17,24,33-34H,12,15H2,(H,31,32)/b30-14+/t17?,24-/m1/s1 |
| InChIKey | RGXRBHXVAHQCIO-TXQNARSNSA-N |
| XLogP | 4.35 |
| TPSA | 111.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.94 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|