C23H31Cl — CID 155111564
(5Z)-5-butylidene-4-chloro-4-ethyl-6,6-dimethyl-1-(4-prop-1-en-2-ylphenyl)cyclohexene (PubChem CID 155111564) has the molecular formula C23H31Cl and a molecular weight of 342.95 g/mol. Its IUPAC name is (5Z)-5-butylidene-4-chloro-4-ethyl-6,6-dimethyl-1-(4-prop-1-en-2-ylphenyl)cyclohexene.
| Compound Name | (5Z)-5-butylidene-4-chloro-4-ethyl-6,6-dimethyl-1-(4-prop-1-en-2-ylphenyl)cyclohexene |
|---|---|
| PubChem CID | 155111564 |
| Molecular Formula | C23H31Cl |
| Molecular Weight | 342.95 g/mol |
| Exact Mass | 342.21 |
| IUPAC Name | (5Z)-5-butylidene-4-chloro-4-ethyl-6,6-dimethyl-1-(4-prop-1-en-2-ylphenyl)cyclohexene |
| SMILES | C=C(C)c1ccc(C2=CCC(Cl)(CC)/C(=C\CCC)C2(C)C)cc1 |
| InChI | InChI=1S/C23H31Cl/c1-7-9-10-21-22(5,6)20(15-16-23(21,24)8-2)19-13-11-18(12-14-19)17(3)4/h10-15H,3,7-9,16H2,1-2,4-6H3/b21-10- |
| InChIKey | RJPDYWDPZYYBCN-FBHDLOMBSA-N |
| XLogP | 7.65 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.95 |
| LogP ≤ 5 | 7.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|