C20H17NO — CID 155112737
1-(1,1-diphenylethyl)-4-nitrosobenzene (PubChem CID 155112737) has the molecular formula C20H17NO and a molecular weight of 287.36 g/mol. Its IUPAC name is 1-(1,1-diphenylethyl)-4-nitrosobenzene.
| Compound Name | 1-(1,1-diphenylethyl)-4-nitrosobenzene |
|---|---|
| PubChem CID | 155112737 |
| Molecular Formula | C20H17NO |
| Molecular Weight | 287.36 g/mol |
| Exact Mass | 287.13 |
| IUPAC Name | 1-(1,1-diphenylethyl)-4-nitrosobenzene |
| SMILES | CC(c1ccccc1)(c1ccccc1)c1ccc(N=O)cc1 |
| InChI | InChI=1S/C20H17NO/c1-20(16-8-4-2-5-9-16,17-10-6-3-7-11-17)18-12-14-19(21-22)15-13-18/h2-15H,1H3 |
| InChIKey | NMXLIPWADVTEPW-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.36 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|