C10H18O6Si — CID 15511275
2-(1,2-dihydroxyethyl)-4-hydroxy-3-(trimethylsilylmethoxy)-2H-furan-5-one (PubChem CID 15511275) has the molecular formula C10H18O6Si and a molecular weight of 262.33 g/mol. Its IUPAC name is 2-(1,2-dihydroxyethyl)-4-hydroxy-3-(trimethylsilylmethoxy)-2H-furan-5-one.
| Compound Name | 2-(1,2-dihydroxyethyl)-4-hydroxy-3-(trimethylsilylmethoxy)-2H-furan-5-one |
|---|---|
| PubChem CID | 15511275 |
| Molecular Formula | C10H18O6Si |
| Molecular Weight | 262.33 g/mol |
| Exact Mass | 262.09 |
| IUPAC Name | 2-(1,2-dihydroxyethyl)-4-hydroxy-3-(trimethylsilylmethoxy)-2H-furan-5-one |
| SMILES | C[Si](C)(C)COC1=C(O)C(=O)OC1C(O)CO |
| InChI | InChI=1S/C10H18O6Si/c1-17(2,3)5-15-9-7(13)10(14)16-8(9)6(12)4-11/h6,8,11-13H,4-5H2,1-3H3 |
| InChIKey | QESNGMPRWFVKJI-UHFFFAOYSA-N |
| XLogP | -0.07 |
| TPSA | 96.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.33 |
| LogP ≤ 5 | -0.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|