C24H24Cl2N4O4 — CID 155113593
7-(3,4-dichlorobenzoyl)-2-[2-hydroxyethyl-[(4-methoxyphenyl)methyl]amino]-3,5,6,8-tetrahydropyrido[3,4-d]pyrimidin-4-one (PubChem CID 155113593) has the molecular formula C24H24Cl2N4O4 and a molecular weight of 503.39 g/mol. Its IUPAC name is 7-(3,4-dichlorobenzoyl)-2-[2-hydroxyethyl-[(4-methoxyphenyl)methyl]amino]-3,5,6,8-tetrahydropyrido[3,4-d]pyrimidin-4-one.
| Compound Name | 7-(3,4-dichlorobenzoyl)-2-[2-hydroxyethyl-[(4-methoxyphenyl)methyl]amino]-3,5,6,8-tetrahydropyrido[3,4-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 155113593 |
| Molecular Formula | C24H24Cl2N4O4 |
| Molecular Weight | 503.39 g/mol |
| Exact Mass | 502.12 |
| IUPAC Name | 7-(3,4-dichlorobenzoyl)-2-[2-hydroxyethyl-[(4-methoxyphenyl)methyl]amino]-3,5,6,8-tetrahydropyrido[3,4-d]pyrimidin-4-one |
| SMILES | COc1ccc(CN(CCO)c2nc3c(c(=O)[nH]2)CCN(C(=O)c2ccc(Cl)c(Cl)c2)C3)cc1 |
| InChI | InChI=1S/C24H24Cl2N4O4/c1-34-17-5-2-15(3-6-17)13-30(10-11-31)24-27-21-14-29(9-8-18(21)22(32)28-24)23(33)16-4-7-19(25)20(26)12-16/h2-7,12,31H,8-11,13-14H2,1H3,(H,27,28,32) |
| InChIKey | SSDMQKNFOVSRLC-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 98.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.39 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |