C19H18ClN3O5S2 — CID 155116421
N-(2-chlorophenyl)sulfonyl-2-(2-ethylsulfonylphenyl)-1-methylimidazole-4-carboxamide (PubChem CID 155116421) has the molecular formula C19H18ClN3O5S2 and a molecular weight of 467.96 g/mol. Its IUPAC name is N-(2-chlorophenyl)sulfonyl-2-(2-ethylsulfonylphenyl)-1-methylimidazole-4-carboxamide.
| Compound Name | N-(2-chlorophenyl)sulfonyl-2-(2-ethylsulfonylphenyl)-1-methylimidazole-4-carboxamide |
|---|---|
| PubChem CID | 155116421 |
| Molecular Formula | C19H18ClN3O5S2 |
| Molecular Weight | 467.96 g/mol |
| Exact Mass | 467.04 |
| IUPAC Name | N-(2-chlorophenyl)sulfonyl-2-(2-ethylsulfonylphenyl)-1-methylimidazole-4-carboxamide |
| SMILES | CCS(=O)(=O)c1ccccc1-c1nc(C(=O)NS(=O)(=O)c2ccccc2Cl)cn1C |
| InChI | InChI=1S/C19H18ClN3O5S2/c1-3-29(25,26)16-10-6-4-8-13(16)18-21-15(12-23(18)2)19(24)22-30(27,28)17-11-7-5-9-14(17)20/h4-12H,3H2,1-2H3,(H,22,24) |
| InChIKey | FZLYJSLSQLQHQK-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 115.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.96 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |