C17H12Cl3N3O3S — CID 155116473
5-chloro-2-(2-chlorophenyl)-N-(2-chlorophenyl)sulfonyl-1-methylimidazole-4-carboxamide (PubChem CID 155116473) has the molecular formula C17H12Cl3N3O3S and a molecular weight of 444.73 g/mol. Its IUPAC name is 5-chloro-2-(2-chlorophenyl)-N-(2-chlorophenyl)sulfonyl-1-methylimidazole-4-carboxamide.
| Compound Name | 5-chloro-2-(2-chlorophenyl)-N-(2-chlorophenyl)sulfonyl-1-methylimidazole-4-carboxamide |
|---|---|
| PubChem CID | 155116473 |
| Molecular Formula | C17H12Cl3N3O3S |
| Molecular Weight | 444.73 g/mol |
| Exact Mass | 442.97 |
| IUPAC Name | 5-chloro-2-(2-chlorophenyl)-N-(2-chlorophenyl)sulfonyl-1-methylimidazole-4-carboxamide |
| SMILES | Cn1c(-c2ccccc2Cl)nc(C(=O)NS(=O)(=O)c2ccccc2Cl)c1Cl |
| InChI | InChI=1S/C17H12Cl3N3O3S/c1-23-15(20)14(21-16(23)10-6-2-3-7-11(10)18)17(24)22-27(25,26)13-9-5-4-8-12(13)19/h2-9H,1H3,(H,22,24) |
| InChIKey | MKVAJMJDGNYQGA-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 81.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.73 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |