C17H13Cl2N3O3S — CID 155116290
4-(2-chlorophenyl)-N-(2-chlorophenyl)sulfonyl-5-methyl-1H-imidazole-2-carboxamide (PubChem CID 155116290) has the molecular formula C17H13Cl2N3O3S and a molecular weight of 410.28 g/mol. Its IUPAC name is 4-(2-chlorophenyl)-N-(2-chlorophenyl)sulfonyl-5-methyl-1H-imidazole-2-carboxamide.
| Compound Name | 4-(2-chlorophenyl)-N-(2-chlorophenyl)sulfonyl-5-methyl-1H-imidazole-2-carboxamide |
|---|---|
| PubChem CID | 155116290 |
| Molecular Formula | C17H13Cl2N3O3S |
| Molecular Weight | 410.28 g/mol |
| Exact Mass | 409.01 |
| IUPAC Name | 4-(2-chlorophenyl)-N-(2-chlorophenyl)sulfonyl-5-methyl-1H-imidazole-2-carboxamide |
| SMILES | Cc1[nH]c(C(=O)NS(=O)(=O)c2ccccc2Cl)nc1-c1ccccc1Cl |
| InChI | InChI=1S/C17H13Cl2N3O3S/c1-10-15(11-6-2-3-7-12(11)18)21-16(20-10)17(23)22-26(24,25)14-9-5-4-8-13(14)19/h2-9H,1H3,(H,20,21)(H,22,23) |
| InChIKey | ADKKQDRIMGWXIY-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 91.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.28 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |