C18H15N3O4S — CID 155116653
methyl 3-[(3-cyano-4-methyl-1H-indol-7-yl)sulfamoyl]benzoate (PubChem CID 155116653) has the molecular formula C18H15N3O4S and a molecular weight of 369.40 g/mol. Its IUPAC name is methyl 3-[(3-cyano-4-methyl-1H-indol-7-yl)sulfamoyl]benzoate.
| Compound Name | methyl 3-[(3-cyano-4-methyl-1H-indol-7-yl)sulfamoyl]benzoate |
|---|---|
| PubChem CID | 155116653 |
| Molecular Formula | C18H15N3O4S |
| Molecular Weight | 369.40 g/mol |
| Exact Mass | 369.08 |
| IUPAC Name | methyl 3-[(3-cyano-4-methyl-1H-indol-7-yl)sulfamoyl]benzoate |
| SMILES | COC(=O)c1cccc(S(=O)(=O)Nc2ccc(C)c3c(C#N)c[nH]c23)c1 |
| InChI | InChI=1S/C18H15N3O4S/c1-11-6-7-15(17-16(11)13(9-19)10-20-17)21-26(23,24)14-5-3-4-12(8-14)18(22)25-2/h3-8,10,20-21H,1-2H3 |
| InChIKey | LNUJCMQXCDSHNR-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 112.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.40 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |