C20H19N3O4S — CID 166148415
propan-2-yl 3-[(3-cyano-4-methyl-1H-indol-7-yl)sulfamoyl]benzoate (PubChem CID 166148415) has the molecular formula C20H19N3O4S and a molecular weight of 397.46 g/mol. Its IUPAC name is propan-2-yl 3-[(3-cyano-4-methyl-1H-indol-7-yl)sulfamoyl]benzoate.
| Compound Name | propan-2-yl 3-[(3-cyano-4-methyl-1H-indol-7-yl)sulfamoyl]benzoate |
|---|---|
| PubChem CID | 166148415 |
| Molecular Formula | C20H19N3O4S |
| Molecular Weight | 397.46 g/mol |
| Exact Mass | 397.11 |
| IUPAC Name | propan-2-yl 3-[(3-cyano-4-methyl-1H-indol-7-yl)sulfamoyl]benzoate |
| SMILES | Cc1ccc(NS(=O)(=O)c2cccc(C(=O)OC(C)C)c2)c2[nH]cc(C#N)c12 |
| InChI | InChI=1S/C20H19N3O4S/c1-12(2)27-20(24)14-5-4-6-16(9-14)28(25,26)23-17-8-7-13(3)18-15(10-21)11-22-19(17)18/h4-9,11-12,22-23H,1-3H3 |
| InChIKey | IPVCOHMRDLGVDY-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 112.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.46 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |