C19H21Cl2N5O2 — CID 155117362
tert-butyl 10,11-dichloro-13-(1-methylpyrazol-3-yl)-4,8,12-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),10,12-tetraene-4-carboxylate (PubChem CID 155117362) has the molecular formula C19H21Cl2N5O2 and a molecular weight of 422.32 g/mol. Its IUPAC name is tert-butyl 10,11-dichloro-13-(1-methylpyrazol-3-yl)-4,8,12-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),10,12-tetraene-4-carboxylate.
| Compound Name | tert-butyl 10,11-dichloro-13-(1-methylpyrazol-3-yl)-4,8,12-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),10,12-tetraene-4-carboxylate |
|---|---|
| PubChem CID | 155117362 |
| Molecular Formula | C19H21Cl2N5O2 |
| Molecular Weight | 422.32 g/mol |
| Exact Mass | 421.11 |
| IUPAC Name | tert-butyl 10,11-dichloro-13-(1-methylpyrazol-3-yl)-4,8,12-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),10,12-tetraene-4-carboxylate |
| SMILES | Cn1ccc(-c2nc(Cl)c(Cl)c3[nH]c4c(c23)CN(C(=O)OC(C)(C)C)CC4)n1 |
| InChI | InChI=1S/C19H21Cl2N5O2/c1-19(2,3)28-18(27)26-8-6-11-10(9-26)13-15(12-5-7-25(4)24-12)23-17(21)14(20)16(13)22-11/h5,7,22H,6,8-9H2,1-4H3 |
| InChIKey | ZDFOSUGYRYAOEQ-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 76.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.32 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|